
5086-74-8
| Name | Tetramisole hydrochloride |
| CAS | 5086-74-8 |
| EINECS(EC#) | 225-799-5 |
| Molecular Formula | C11H13ClN2S |
| MDL Number | MFCD00005536 |
| Molecular Weight | 240.75 |
| MOL File | 5086-74-8.mol |
Chemical Properties
| Appearance | white to pale cream crystalline powder |
| Melting point | 266-267 °C(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Methanol (Slightly), Water (Slightly, Heated) |
| form | Solid |
| color | White to Off-White |
| biological source | synthetic (organic) |
| Water Solubility | 200 g/L (20 ºC) |
| Merck | 13,5480 |
| BRN | 4358989 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C11H12N2S.ClH/c1-2-4-9(5-3-1)10-8-13-6-7-14-11(13)12-10;/h1-5,10H,6-8H2;1H |
| InChIKey | LAZPBGZRMVRFKY-UHFFFAOYSA-N |
| SMILES | C1N2C(=NC(C2)C2=CC=CC=C2)SC1.[H]Cl |
| CAS DataBase Reference | 5086-74-8(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | NJ5950000 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |
